C39H42O6 — CID 165344540
2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]cyclopentan-1-one (PubChem CID 165344540) has the molecular formula C39H42O6 and a molecular weight of 606.76 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]cyclopentan-1-one.
| Compound Name | 2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 165344540 |
| Molecular Formula | C39H42O6 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]cyclopentan-1-one |
| SMILES | O=C1CCCC1[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C39H42O6/c40-34-23-13-22-33(34)36-38(43-26-31-18-9-3-10-19-31)39(44-27-32-20-11-4-12-21-32)37(42-25-30-16-7-2-8-17-30)35(45-36)28-41-24-29-14-5-1-6-15-29/h1-12,14-21,33,35-39H,13,22-28H2/t33?,35-,36-,37-,38?,39+/m1/s1 |
| InChIKey | UPXDMRYXHHQDPK-QZYUOGDPSA-N |
| XLogP | 7.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |