C40H42N2O8 — CID 11828552
(4R)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 11828552) has the molecular formula C40H42N2O8 and a molecular weight of 678.78 g/mol. Its IUPAC name is (4R)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylic acid.
| Compound Name | (4R)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 11828552 |
| Molecular Formula | C40H42N2O8 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | (4R)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)[C@H]([C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C40H42N2O8/c1-27-33(39(43)44)34(42-40(45)41-27)36-38(49-25-31-20-12-5-13-21-31)37(48-24-30-18-10-4-11-19-30)35(47-23-29-16-8-3-9-17-29)32(50-36)26-46-22-28-14-6-2-7-15-28/h2-21,32,34-38H,22-26H2,1H3,(H,43,44)(H2,41,42,45)/t32-,34-,35+,36+,37+,38?/m1/s1 |
| InChIKey | QSLKJINYNIOUGQ-QKEOXOSVSA-N |
| XLogP | 5.77 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |