C42H46N2O8 — CID 11136275
ethyl (4S)-6-methyl-2-oxo-4-[(2S,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 11136275) has the molecular formula C42H46N2O8 and a molecular weight of 706.84 g/mol. Its IUPAC name is ethyl (4S)-6-methyl-2-oxo-4-[(2S,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-methyl-2-oxo-4-[(2S,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11136275 |
| Molecular Formula | C42H46N2O8 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | ethyl (4S)-6-methyl-2-oxo-4-[(2S,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@@H]1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H46N2O8/c1-3-48-41(45)35-29(2)43-42(46)44-36(35)38-40(51-27-33-22-14-7-15-23-33)39(50-26-32-20-12-6-13-21-32)37(49-25-31-18-10-5-11-19-31)34(52-38)28-47-24-30-16-8-4-9-17-30/h4-23,34,36-40H,3,24-28H2,1-2H3,(H2,43,44,46)/t34-,36+,37-,38+,39+,40?/m1/s1 |
| InChIKey | AALFQAIXWFYHFJ-LWSGYBNNSA-N |
| XLogP | 6.25 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |