C47H48N2O8 — CID 10952804
benzyl (4S)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 10952804) has the molecular formula C47H48N2O8 and a molecular weight of 768.91 g/mol. Its IUPAC name is benzyl (4S)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl (4S)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10952804 |
| Molecular Formula | C47H48N2O8 |
| Molecular Weight | 768.91 g/mol |
| Exact Mass | 768.34 |
| IUPAC Name | benzyl (4S)-6-methyl-2-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@@H]([C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C47H48N2O8/c1-33-40(46(50)56-31-38-25-15-6-16-26-38)41(49-47(51)48-33)43-45(55-30-37-23-13-5-14-24-37)44(54-29-36-21-11-4-12-22-36)42(53-28-35-19-9-3-10-20-35)39(57-43)32-52-27-34-17-7-2-8-18-34/h2-26,39,41-45H,27-32H2,1H3,(H2,48,49,51)/t39-,41+,42+,43+,44+,45?/m1/s1 |
| InChIKey | NDEPGJJGVPKXMI-FMQNRPSZSA-N |
| XLogP | 7.43 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.91 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |