C39H40N2O7 — CID 10919361
ethyl (4S)-6-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 10919361) has the molecular formula C39H40N2O7 and a molecular weight of 648.76 g/mol. Its IUPAC name is ethyl (4S)-6-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10919361 |
| Molecular Formula | C39H40N2O7 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | ethyl (4S)-6-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)NC(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C39H40N2O7/c1-2-45-38(42)32-33(30-21-13-6-14-22-30)40-39(43)41-34(32)36-37(47-25-29-19-11-5-12-20-29)35(46-24-28-17-9-4-10-18-28)31(48-36)26-44-23-27-15-7-3-8-16-27/h3-22,31,33,35-37H,2,23-26H2,1H3,(H2,40,41,43)/t31-,33+,35-,36+,37-/m1/s1 |
| InChIKey | DBUSTQDHMLZLQC-KVJIXYHLSA-N |
| XLogP | 6.01 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |