C15H11F17O7 — CID 165362518
6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 165362518) has the molecular formula C15H11F17O7 and a molecular weight of 626.21 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 165362518 |
| Molecular Formula | C15H11F17O7 |
| Molecular Weight | 626.21 g/mol |
| Exact Mass | 626.02 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(O)C(O)C1O |
| InChI | InChI=1S/C15H11F17O7/c16-8(17,1-38-7-4(35)2(33)3(34)5(39-7)6(36)37)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h2-5,7,33-35H,1H2,(H,36,37) |
| InChIKey | RYSOJIPWMVREAU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|