C21H13F28NO3 — CID 165365044
2-[dimethyl-(4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-octacosafluoro-2-hydroxyheptadec-3-enyl)azaniumyl]acetate (PubChem CID 165365044) has the molecular formula C21H13F28NO3 and a molecular weight of 859.28 g/mol. Its IUPAC name is 2-[dimethyl-(4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-octacosafluoro-2-hydroxyheptadec-3-enyl)azaniumyl]acetate.
| Compound Name | 2-[dimethyl-(4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-octacosafluoro-2-hydroxyheptadec-3-enyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 165365044 |
| Molecular Formula | C21H13F28NO3 |
| Molecular Weight | 859.28 g/mol |
| Exact Mass | 859.04 |
| IUPAC Name | 2-[dimethyl-(4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-octacosafluoro-2-hydroxyheptadec-3-enyl)azaniumyl]acetate |
| SMILES | C[N+](C)(CC(=O)[O-])CC(O)C=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H13F28NO3/c1-50(2,5-8(52)53)4-6(51)3-7(22)9(23,24)10(25,26)11(27,28)12(29,30)13(31,32)14(33,34)15(35,36)16(37,38)17(39,40)18(41,42)19(43,44)20(45,46)21(47,48)49/h3,6,51H,4-5H2,1-2H3 |
| InChIKey | VNUYCSBVDAIELM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.28 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|