C27H45N5O10 — CID 165366129
2-methoxyethyl N-[1-[2-[7-(2,5-dioxopyrrol-1-yl)heptanoylamino]ethylamino]-6-(2-methoxyethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 165366129) has the molecular formula C27H45N5O10 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-methoxyethyl N-[1-[2-[7-(2,5-dioxopyrrol-1-yl)heptanoylamino]ethylamino]-6-(2-methoxyethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[1-[2-[7-(2,5-dioxopyrrol-1-yl)heptanoylamino]ethylamino]-6-(2-methoxyethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 165366129 |
| Molecular Formula | C27H45N5O10 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 2-methoxyethyl N-[1-[2-[7-(2,5-dioxopyrrol-1-yl)heptanoylamino]ethylamino]-6-(2-methoxyethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COCCOC(=O)NCCCCC(NC(=O)OCCOC)C(=O)NCCNC(=O)CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H45N5O10/c1-39-17-19-41-26(37)30-13-7-6-9-21(31-27(38)42-20-18-40-2)25(36)29-15-14-28-22(33)10-5-3-4-8-16-32-23(34)11-12-24(32)35/h11-12,21H,3-10,13-20H2,1-2H3,(H,28,33)(H,29,36)(H,30,37)(H,31,38) |
| InChIKey | LBHWOHWHKYVENS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 190.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|