C30H45N5O13W — CID 21026672
3-(2-methoxyethoxy)propyl N-[1-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-[3-(2-methoxyethoxy)propoxycarbonylamino]-1-oxohexan-2-yl]carbamate;pyrrol-1-ide-2,5-dione;tungsten(2+) (PubChem CID 21026672) has the molecular formula C30H45N5O13W and a molecular weight of 867.55 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)propyl N-[1-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-[3-(2-methoxyethoxy)propoxycarbonylamino]-1-oxohexan-2-yl]carbamate;pyrrol-1-ide-2,5-dione;tungsten(2+).
| Compound Name | 3-(2-methoxyethoxy)propyl N-[1-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-[3-(2-methoxyethoxy)propoxycarbonylamino]-1-oxohexan-2-yl]carbamate;pyrrol-1-ide-2,5-dione;tungsten(2+) |
|---|---|
| PubChem CID | 21026672 |
| Molecular Formula | C30H45N5O13W |
| Molecular Weight | 867.55 g/mol |
| Exact Mass | 867.25 |
| IUPAC Name | 3-(2-methoxyethoxy)propyl N-[1-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-[3-(2-methoxyethoxy)propoxycarbonylamino]-1-oxohexan-2-yl]carbamate;pyrrol-1-ide-2,5-dione;tungsten(2+) |
| SMILES | COCCOCCCOC(=O)NCCCCC(NC(=O)OCCCOCCOC)C(=O)N[CH-]CN1C(=O)C=CC1=O.O=C1C=CC(=O)[N-]1.[W+2] |
| InChI | InChI=1S/C26H43N4O11.C4H3NO2.W/c1-36-17-19-38-13-5-15-40-25(34)28-10-4-3-7-21(29-26(35)41-16-6-14-39-20-18-37-2)24(33)27-11-12-30-22(31)8-9-23(30)32;6-3-1-2-4(7)5-3;/h8-9,11,21H,3-7,10,12-20H2,1-2H3,(H,27,33)(H,28,34)(H,29,35);1-2H,(H,5,6,7);/q-1;;+2/p-1 |
| InChIKey | LJMGWSNJPCMXCM-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.55 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|