C14H19NO — CID 165370224
(1S,3aS,8S,8aS)-8-isocyanato-1-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydro-s-indacene (PubChem CID 165370224) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1S,3aS,8S,8aS)-8-isocyanato-1-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydro-s-indacene.
| Compound Name | (1S,3aS,8S,8aS)-8-isocyanato-1-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydro-s-indacene |
|---|---|
| PubChem CID | 165370224 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1S,3aS,8S,8aS)-8-isocyanato-1-methyl-1,2,3,3a,4,5,6,7,8,8a-decahydro-s-indacene |
| SMILES | C[C@H]1CC[C@H]2CC3=C(CCC3)[C@@H](N=C=O)[C@H]21 |
| InChI | InChI=1S/C14H19NO/c1-9-5-6-11-7-10-3-2-4-12(10)14(13(9)11)15-8-16/h9,11,13-14H,2-7H2,1H3/t9-,11-,13-,14+/m0/s1 |
| InChIKey | SGGPTNQJFLDJOV-DTCNJJKHSA-N |
| XLogP | 3.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|