C9H5BrF5IO — CID 165412330
2-bromo-4-iodo-1-(2,2,3,3,3-pentafluoropropoxy)benzene (PubChem CID 165412330) has the molecular formula C9H5BrF5IO and a molecular weight of 430.94 g/mol. Its IUPAC name is 2-bromo-4-iodo-1-(2,2,3,3,3-pentafluoropropoxy)benzene.
| Compound Name | 2-bromo-4-iodo-1-(2,2,3,3,3-pentafluoropropoxy)benzene |
|---|---|
| PubChem CID | 165412330 |
| Molecular Formula | C9H5BrF5IO |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 429.85 |
| IUPAC Name | 2-bromo-4-iodo-1-(2,2,3,3,3-pentafluoropropoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)COc1ccc(I)cc1Br |
| InChI | InChI=1S/C9H5BrF5IO/c10-6-3-5(16)1-2-7(6)17-4-8(11,12)9(13,14)15/h1-3H,4H2 |
| InChIKey | MDWPXRCHUGYQFR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|