C44H48ClN3O — CID 165429183
6-[2-[(1E,3E,5E)-5-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]-N-prop-2-ynylhexanamide chloride (PubChem CID 165429183) has the molecular formula C44H48ClN3O and a molecular weight of 670.34 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]-N-prop-2-ynylhexanamide chloride.
| Compound Name | 6-[2-[(1E,3E,5E)-5-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]-N-prop-2-ynylhexanamide chloride |
|---|---|
| PubChem CID | 165429183 |
| Molecular Formula | C44H48ClN3O |
| Molecular Weight | 670.34 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium-3-yl]-N-prop-2-ynylhexanamide chloride |
| SMILES | C#CCNC(=O)CCCCC[N+]1=C(/C=C/C=C/C=C2/N(CC)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21.[Cl-] |
| InChI | InChI=1S/C44H47N3O.ClH/c1-7-30-45-40(48)25-13-10-18-31-47-37-29-27-33-20-15-17-22-35(33)42(37)44(5,6)39(47)24-12-9-11-23-38-43(3,4)41-34-21-16-14-19-32(34)26-28-36(41)46(38)8-2;/h1,9,11-12,14-17,19-24,26-29H,8,10,13,18,25,30-31H2,2-6H3;1H |
| InChIKey | MRIASOGGINCJNY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|