C10H10N2O3 — CID 165437933
2-(6-hydroxy-1-benzofuran-3-yl)acetohydrazide (PubChem CID 165437933) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(6-hydroxy-1-benzofuran-3-yl)acetohydrazide.
| Compound Name | 2-(6-hydroxy-1-benzofuran-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 165437933 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-(6-hydroxy-1-benzofuran-3-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1coc2cc(O)ccc12 |
| InChI | InChI=1S/C10H10N2O3/c11-12-10(14)3-6-5-15-9-4-7(13)1-2-8(6)9/h1-2,4-5,13H,3,11H2,(H,12,14) |
| InChIKey | KOECNOPPSQARCD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|