C10H16F3NO — CID 165450826
3-amino-2-(cyclohepten-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 165450826) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-amino-2-(cyclohepten-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(cyclohepten-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 165450826 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-amino-2-(cyclohepten-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(C1=CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)9(15,7-14)8-5-3-1-2-4-6-8/h5,15H,1-4,6-7,14H2 |
| InChIKey | WITXWJHSCFTOTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|