C25H27F3N2O5 — CID 165460750
4-[[5-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoyl]amino]butanoic acid (PubChem CID 165460750) has the molecular formula C25H27F3N2O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-[[5-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoyl]amino]butanoic acid.
| Compound Name | 4-[[5-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 165460750 |
| Molecular Formula | C25H27F3N2O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-[[5-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CC(CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C25H27F3N2O5/c26-25(27,28)16(14-22(31)29-12-5-10-23(32)33)11-13-30-24(34)35-15-21-19-8-3-1-6-17(19)18-7-2-4-9-20(18)21/h1-4,6-9,16,21H,5,10-15H2,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | LHMWDMVFTHVDMX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|