C26H28N2O5 — CID 165468106
3-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 165468106) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | 3-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 165468106 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]-3-azabicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | O=C(NCCCCC(=O)N1CC2CC2(C(=O)O)C1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H28N2O5/c29-23(28-14-17-13-26(17,16-28)24(30)31)11-5-6-12-27-25(32)33-15-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-4,7-10,17,22H,5-6,11-16H2,(H,27,32)(H,30,31) |
| InChIKey | ILNCOIMMZKZMKO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|