C15H17F3O3 — CID 165476029
2-propyl-4-[4-(trifluoromethyl)phenyl]oxolane-3-carboxylic acid (PubChem CID 165476029) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-propyl-4-[4-(trifluoromethyl)phenyl]oxolane-3-carboxylic acid.
| Compound Name | 2-propyl-4-[4-(trifluoromethyl)phenyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 165476029 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-propyl-4-[4-(trifluoromethyl)phenyl]oxolane-3-carboxylic acid |
| SMILES | CCCC1OCC(c2ccc(C(F)(F)F)cc2)C1C(=O)O |
| InChI | InChI=1S/C15H17F3O3/c1-2-3-12-13(14(19)20)11(8-21-12)9-4-6-10(7-5-9)15(16,17)18/h4-7,11-13H,2-3,8H2,1H3,(H,19,20) |
| InChIKey | BAOLIABNAGWMSZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |