C21H22FN3O3S2 — CID 16550277
N-(5-benzyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide (PubChem CID 16550277) has the molecular formula C21H22FN3O3S2 and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 16550277 |
| Molecular Formula | C21H22FN3O3S2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ncc(Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C21H22FN3O3S2/c1-3-25(4-2)30(27,28)17-10-11-19(22)18(13-17)20(26)24-21-23-14-16(29-21)12-15-8-6-5-7-9-15/h5-11,13-14H,3-4,12H2,1-2H3,(H,23,24,26) |
| InChIKey | GXZXPZLHIUXSKK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |