C20H21ClO4S2 — CID 16561334
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate (PubChem CID 16561334) has the molecular formula C20H21ClO4S2 and a molecular weight of 424.97 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 16561334 |
| Molecular Formula | C20H21ClO4S2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)COc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C20H21ClO4S2/c1-12-8-15(21)9-13(2)19(12)24-11-18(22)25-16-5-4-14(10-17(16)23-3)20-26-6-7-27-20/h4-5,8-10,20H,6-7,11H2,1-3H3 |
| InChIKey | SZUIVIXWEBPYBN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|