C21H24O3S2 — CID 33081951
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2,4-dimethylphenyl)propanoate (PubChem CID 33081951) has the molecular formula C21H24O3S2 and a molecular weight of 388.55 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2,4-dimethylphenyl)propanoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 33081951 |
| Molecular Formula | C21H24O3S2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-(2,4-dimethylphenyl)propanoate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)CCc1ccc(C)cc1C |
| InChI | InChI=1S/C21H24O3S2/c1-14-4-5-16(15(2)12-14)7-9-20(22)24-18-8-6-17(13-19(18)23-3)21-25-10-11-26-21/h4-6,8,12-13,21H,7,9-11H2,1-3H3 |
| InChIKey | CPSKHPKGWIAYFI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|