C32H43Cl2OTi- — CID 166006375
carbanide;2,4-ditert-butyl-6-[2-(4,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)phenyl]phenol;dichlorotitanium (PubChem CID 166006375) has the molecular formula C32H43Cl2OTi- and a molecular weight of 562.47 g/mol. Its IUPAC name is carbanide;2,4-ditert-butyl-6-[2-(4,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)phenyl]phenol;dichlorotitanium.
| Compound Name | carbanide;2,4-ditert-butyl-6-[2-(4,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)phenyl]phenol;dichlorotitanium |
|---|---|
| PubChem CID | 166006375 |
| Molecular Formula | C32H43Cl2OTi- |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | carbanide;2,4-ditert-butyl-6-[2-(4,7-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)phenyl]phenol;dichlorotitanium |
| SMILES | CC1=CC=C(C)C2CC(c3ccccc3-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)CC12.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C31H40O.CH3.2ClH.Ti/c1-19-13-14-20(2)26-16-21(15-25(19)26)23-11-9-10-12-24(23)27-17-22(30(3,4)5)18-28(29(27)32)31(6,7)8;;;;/h9-14,17-18,21,25-26,32H,15-16H2,1-8H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | NXDBTGBAXZVNSA-UHFFFAOYSA-L |
| XLogP | 10.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|