C29H30F2O — CID 166006395
2,4-ditert-butyl-6-[2-(4,7-difluoro-1H-inden-2-yl)phenyl]phenol (PubChem CID 166006395) has the molecular formula C29H30F2O and a molecular weight of 432.55 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-(4,7-difluoro-1H-inden-2-yl)phenyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-(4,7-difluoro-1H-inden-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 166006395 |
| Molecular Formula | C29H30F2O |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-(4,7-difluoro-1H-inden-2-yl)phenyl]phenol |
| SMILES | CC(C)(C)c1cc(-c2ccccc2C2=Cc3c(F)ccc(F)c3C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H30F2O/c1-28(2,3)18-15-23(27(32)24(16-18)29(4,5)6)20-10-8-7-9-19(20)17-13-21-22(14-17)26(31)12-11-25(21)30/h7-13,15-16,32H,14H2,1-6H3 |
| InChIKey | APTQARZXIGVBNL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|