C20H18GeIrNS- — CID 166018674
iridium;trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-6-yl)germane (PubChem CID 166018674) has the molecular formula C20H18GeIrNS- and a molecular weight of 569.27 g/mol. Its IUPAC name is iridium;trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-6-yl)germane.
| Compound Name | iridium;trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-6-yl)germane |
|---|---|
| PubChem CID | 166018674 |
| Molecular Formula | C20H18GeIrNS- |
| Molecular Weight | 569.27 g/mol |
| Exact Mass | 571.00 |
| IUPAC Name | iridium;trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-6-yl)germane |
| SMILES | C[Ge](C)(C)c1ccc2sc3cnc(-c4[c-]cccc4)cc3c2c1.[Ir] |
| InChI | InChI=1S/C20H18GeNS.Ir/c1-21(2,3)15-9-10-19-16(11-15)17-12-18(22-13-20(17)23-19)14-7-5-4-6-8-14;/h4-7,9-13H,1-3H3;/q-1; |
| InChIKey | RYHUVHKOUYNGTO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|