C25H23BrN2O2 — CID 166024524
N-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)-3-methylbenzamide (PubChem CID 166024524) has the molecular formula C25H23BrN2O2 and a molecular weight of 463.38 g/mol. Its IUPAC name is N-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)-3-methylbenzamide.
| Compound Name | N-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 166024524 |
| Molecular Formula | C25H23BrN2O2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCc2cc(-c3ccc(Br)cc3)no2)ccc1C#CC1CCCC1 |
| InChI | InChI=1S/C25H23BrN2O2/c1-17-14-21(9-8-19(17)7-6-18-4-2-3-5-18)25(29)27-16-23-15-24(28-30-23)20-10-12-22(26)13-11-20/h8-15,18H,2-5,16H2,1H3,(H,27,29) |
| InChIKey | GXHRIUAXZUXKGL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|