C25H22ClNO3 — CID 166024592
[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)-3-methylbenzoate (PubChem CID 166024592) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)-3-methylbenzoate.
| Compound Name | [3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)-3-methylbenzoate |
|---|---|
| PubChem CID | 166024592 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCc2cc(-c3ccccc3Cl)no2)ccc1C#CC1CCCC1 |
| InChI | InChI=1S/C25H22ClNO3/c1-17-14-20(13-12-19(17)11-10-18-6-2-3-7-18)25(28)29-16-21-15-24(27-30-21)22-8-4-5-9-23(22)26/h4-5,8-9,12-15,18H,2-3,6-7,16H2,1H3 |
| InChIKey | JNKUOGBAIHPLJR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|