C25H22ClNO4 — CID 166024503
[3-(3-methoxyphenyl)-1,2-oxazol-5-yl]methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate (PubChem CID 166024503) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1,2-oxazol-5-yl]methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate.
| Compound Name | [3-(3-methoxyphenyl)-1,2-oxazol-5-yl]methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate |
|---|---|
| PubChem CID | 166024503 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [3-(3-methoxyphenyl)-1,2-oxazol-5-yl]methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate |
| SMILES | COc1cccc(-c2cc(COC(=O)c3ccc(C#CC4CCCC4)c(Cl)c3)on2)c1 |
| InChI | InChI=1S/C25H22ClNO4/c1-29-21-8-4-7-19(13-21)24-15-22(31-27-24)16-30-25(28)20-12-11-18(23(26)14-20)10-9-17-5-2-3-6-17/h4,7-8,11-15,17H,2-3,5-6,16H2,1H3 |
| InChIKey | YLQLSCBTYHEPFD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|