C24H20ClNO3 — CID 166024547
(3-phenyl-1,2-oxazol-5-yl)methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate (PubChem CID 166024547) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate |
|---|---|
| PubChem CID | 166024547 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-chloro-4-(2-cyclopentylethynyl)benzoate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)c1ccc(C#CC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClNO3/c25-22-14-20(13-12-18(22)11-10-17-6-4-5-7-17)24(27)28-16-21-15-23(26-29-21)19-8-2-1-3-9-19/h1-3,8-9,12-15,17H,4-7,16H2 |
| InChIKey | IPLBSPIMVQMFER-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|