C24H20Cl2N2O2 — CID 166024560
3-chloro-N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)benzamide (PubChem CID 166024560) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is 3-chloro-N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)benzamide.
| Compound Name | 3-chloro-N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)benzamide |
|---|---|
| PubChem CID | 166024560 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 3-chloro-N-[[3-(2-chlorophenyl)-1,2-oxazol-5-yl]methyl]-4-(2-cyclopentylethynyl)benzamide |
| SMILES | O=C(NCc1cc(-c2ccccc2Cl)no1)c1ccc(C#CC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c25-21-8-4-3-7-20(21)23-14-19(30-28-23)15-27-24(29)18-12-11-17(22(26)13-18)10-9-16-5-1-2-6-16/h3-4,7-8,11-14,16H,1-2,5-6,15H2,(H,27,29) |
| InChIKey | RRUUVFGEJFJLQJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|