C46H41BN4O2 — CID 166029340
1-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-3-methyl-9-(2,4,6-trimethylphenyl)-2H-[1,4]benzoxaborinino[2,3-d]imidazol-3-ium-2-ide (PubChem CID 166029340) has the molecular formula C46H41BN4O2 and a molecular weight of 692.67 g/mol. Its IUPAC name is 1-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-3-methyl-9-(2,4,6-trimethylphenyl)-2H-[1,4]benzoxaborinino[2,3-d]imidazol-3-ium-2-ide.
| Compound Name | 1-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-3-methyl-9-(2,4,6-trimethylphenyl)-2H-[1,4]benzoxaborinino[2,3-d]imidazol-3-ium-2-ide |
|---|---|
| PubChem CID | 166029340 |
| Molecular Formula | C46H41BN4O2 |
| Molecular Weight | 692.67 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | 1-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-3-methyl-9-(2,4,6-trimethylphenyl)-2H-[1,4]benzoxaborinino[2,3-d]imidazol-3-ium-2-ide |
| SMILES | Cc1cc(C)c(B2c3ccccc3Oc3c2n(-c2cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c2)[c-][n+]3C)c(C)c1 |
| InChI | InChI=1S/C46H41BN4O2/c1-29-23-30(2)43(31(3)24-29)47-38-16-9-11-18-41(38)53-45-44(47)50(28-49(45)7)33-13-12-14-34(26-33)52-35-19-20-37-36-15-8-10-17-39(36)51(40(37)27-35)42-25-32(21-22-48-42)46(4,5)6/h8-27H,1-7H3 |
| InChIKey | POPDAVQDLDRRNS-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.67 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|