C16H11F2N5 — CID 166043284
5-(2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepin-9-amine (PubChem CID 166043284) has the molecular formula C16H11F2N5 and a molecular weight of 311.30 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepin-9-amine.
| Compound Name | 5-(2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepin-9-amine |
|---|---|
| PubChem CID | 166043284 |
| Molecular Formula | C16H11F2N5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-(2,6-difluorophenyl)-1,4-dihydropyrazolo[4,5-d][1,3]benzodiazepin-9-amine |
| SMILES | Nc1ccc2c(c1)-c1[nH]ncc1NC(c1c(F)cccc1F)=N2 |
| InChI | InChI=1S/C16H11F2N5/c17-10-2-1-3-11(18)14(10)16-21-12-5-4-8(19)6-9(12)15-13(22-16)7-20-23-15/h1-7H,19H2,(H,20,23)(H,21,22) |
| InChIKey | RLJDWEMZHIUZQD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|