C20H22NSSi+ — CID 166053558
(3,16-dimethyl-8-thia-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-6-yl)-trimethylsilane (PubChem CID 166053558) has the molecular formula C20H22NSSi+ and a molecular weight of 336.56 g/mol. Its IUPAC name is (3,16-dimethyl-8-thia-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-6-yl)-trimethylsilane.
| Compound Name | (3,16-dimethyl-8-thia-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-6-yl)-trimethylsilane |
|---|---|
| PubChem CID | 166053558 |
| Molecular Formula | C20H22NSSi+ |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (3,16-dimethyl-8-thia-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-6-yl)-trimethylsilane |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c([Si](C)(C)C)cc[n+]1C)S3 |
| InChI | InChI=1S/C20H22NSSi/c1-13-9-10-14-7-6-8-15-18(14)17(13)19-20(22-15)16(23(3,4)5)11-12-21(19)2/h6-12H,1-5H3/q+1 |
| InChIKey | KKHWJYKYDOLEMW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|