C14H34N4O8Si2 — CID 166059659
3-[[4-(carbamoylamino)butoxy-dimethoxysilyl]methoxy-dimethoxysilyl]propylurea (PubChem CID 166059659) has the molecular formula C14H34N4O8Si2 and a molecular weight of 442.62 g/mol. Its IUPAC name is 3-[[4-(carbamoylamino)butoxy-dimethoxysilyl]methoxy-dimethoxysilyl]propylurea.
| Compound Name | 3-[[4-(carbamoylamino)butoxy-dimethoxysilyl]methoxy-dimethoxysilyl]propylurea |
|---|---|
| PubChem CID | 166059659 |
| Molecular Formula | C14H34N4O8Si2 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[[4-(carbamoylamino)butoxy-dimethoxysilyl]methoxy-dimethoxysilyl]propylurea |
| SMILES | CO[Si](CCCNC(N)=O)(OC)OC[Si](OC)(OC)OCCCCNC(N)=O |
| InChI | InChI=1S/C14H34N4O8Si2/c1-21-27(22-2,11-7-9-18-14(16)20)26-12-28(23-3,24-4)25-10-6-5-8-17-13(15)19/h5-12H2,1-4H3,(H3,15,17,19)(H3,16,18,20) |
| InChIKey | DZPXXOGDNHNNNY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 165.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|