C12H14N6O3 — CID 166061076
N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyrimidine-4-carboxamide (PubChem CID 166061076) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166061076 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyrimidine-4-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1ccncn1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C12H14N6O3/c13-10(16-11(19)8-3-4-14-6-15-8)9-2-1-7-5-17(9)12(20)18(7)21/h3-4,6-7,9,21H,1-2,5H2,(H2,13,16,19)/t7-,9+/m1/s1 |
| InChIKey | PRBDLWHLJQPMJV-APPZFPTMSA-N |
| XLogP | -0.16 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|