C23H28N2O2 — CID 166091417
(2E)-3-(cyclobutylmethyl)-N-(8-methyl-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide (PubChem CID 166091417) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2E)-3-(cyclobutylmethyl)-N-(8-methyl-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide.
| Compound Name | (2E)-3-(cyclobutylmethyl)-N-(8-methyl-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 166091417 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2E)-3-(cyclobutylmethyl)-N-(8-methyl-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
| SMILES | C=C/C(CC1CCC1)=C(\C=C/C)C(=O)Nc1cc(C)c2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C23H28N2O2/c1-4-7-20(17(5-2)13-16-8-6-9-16)23(27)24-19-12-15(3)22-18(14-19)10-11-21(26)25-22/h4-5,7,12,14,16H,2,6,8-11,13H2,1,3H3,(H,24,27)(H,25,26)/b7-4-,20-17- |
| InChIKey | BYLQPXDGTHMBMN-OXPAGPQXSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|