C14H16F3NOY-2 — CID 166108129
carbanide;5-[2-methoxy-4-(trifluoromethyl)benzene-5-id-1-yl]-1,2,3,6-tetrahydropyridine;yttrium (PubChem CID 166108129) has the molecular formula C14H16F3NOY-2 and a molecular weight of 360.19 g/mol. Its IUPAC name is carbanide;5-[2-methoxy-4-(trifluoromethyl)benzene-5-id-1-yl]-1,2,3,6-tetrahydropyridine;yttrium.
| Compound Name | carbanide;5-[2-methoxy-4-(trifluoromethyl)benzene-5-id-1-yl]-1,2,3,6-tetrahydropyridine;yttrium |
|---|---|
| PubChem CID | 166108129 |
| Molecular Formula | C14H16F3NOY-2 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | carbanide;5-[2-methoxy-4-(trifluoromethyl)benzene-5-id-1-yl]-1,2,3,6-tetrahydropyridine;yttrium |
| SMILES | COc1cc(C(F)(F)F)[c-]cc1C1=CCCNC1.[CH3-].[Y] |
| InChI | InChI=1S/C13H13F3NO.CH3.Y/c1-18-12-7-10(13(14,15)16)4-5-11(12)9-3-2-6-17-8-9;;/h3,5,7,17H,2,6,8H2,1H3;1H3;/q2*-1; |
| InChIKey | JYCNAHVFBYISJE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|