C33H40N4O5 — CID 166123901
[(1R,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N-[(E)-3-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]prop-1-enyl]carbamate (PubChem CID 166123901) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is [(1R,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N-[(E)-3-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]prop-1-enyl]carbamate.
| Compound Name | [(1R,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N-[(E)-3-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]prop-1-enyl]carbamate |
|---|---|
| PubChem CID | 166123901 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(1R,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] N-[(E)-3-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]prop-1-enyl]carbamate |
| SMILES | COc1ccc2c3c1OC1C[C@H](OC(=O)N/C=C/COc4cccc5[nH]cc(CCN(C)C)c45)C=C[C@]31CCN(C)C2 |
| InChI | InChI=1S/C33H40N4O5/c1-36(2)16-12-22-20-35-25-7-5-8-26(29(22)25)40-18-6-15-34-32(38)41-24-11-13-33-14-17-37(3)21-23-9-10-27(39-4)31(30(23)33)42-28(33)19-24/h5-11,13,15,20,24,28,35H,12,14,16-19,21H2,1-4H3,(H,34,38)/b15-6+/t24-,28?,33-/m1/s1 |
| InChIKey | APQOHMBFVXIQER-UHQOZZIYSA-N |
| XLogP | 4.76 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|