C19H22ClN5O4 — CID 166124085
(2R,3S,4R,5R)-5-[4-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 166124085) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-[4-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-[4-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 166124085 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R,3S,4R,5R)-5-[4-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@@H](CO)O[C@@H](n2ncc3c(N4C[C@H]5CCC[C@H]5C4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C19H22ClN5O4/c1-2-19(28)13(9-26)29-17(14(19)27)25-16-12(6-21-25)15(22-18(20)23-16)24-7-10-4-3-5-11(10)8-24/h1,6,10-11,13-14,17,26-28H,3-5,7-9H2/t10-,11+,13-,14+,17-,19-/m1/s1 |
| InChIKey | KEJWZGVHVBZERO-IGHDHQPTSA-N |
| XLogP | 0.33 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|