C16H21BClF2NO3 — CID 166131149
N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-difluoroethyl]acetamide (PubChem CID 166131149) has the molecular formula C16H21BClF2NO3 and a molecular weight of 359.61 g/mol. Its IUPAC name is N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-difluoroethyl]acetamide.
| Compound Name | N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-difluoroethyl]acetamide |
|---|---|
| PubChem CID | 166131149 |
| Molecular Formula | C16H21BClF2NO3 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-difluoroethyl]acetamide |
| SMILES | CC(=O)NC(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1Cl)C(F)F |
| InChI | InChI=1S/C16H21BClF2NO3/c1-9(22)21-13(14(19)20)11-7-6-10(8-12(11)18)17-23-15(2,3)16(4,5)24-17/h6-8,13-14H,1-5H3,(H,21,22) |
| InChIKey | WDVXKYKRMNIGMQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|