C16H24N6 — CID 166149360
methanamine;1,2,3,4-tetrahydro-2,6-naphthyridine;5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 166149360) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is methanamine;1,2,3,4-tetrahydro-2,6-naphthyridine;5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | methanamine;1,2,3,4-tetrahydro-2,6-naphthyridine;5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 166149360 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | methanamine;1,2,3,4-tetrahydro-2,6-naphthyridine;5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | CN.c1cc2c(cn1)CCNC2.c1ncc2c(n1)CNCC2 |
| InChI | InChI=1S/C8H10N2.C7H9N3.CH5N/c1-3-9-6-8-2-4-10-5-7(1)8;1-2-8-4-7-6(1)3-9-5-10-7;1-2/h1,3,6,10H,2,4-5H2;3,5,8H,1-2,4H2;2H2,1H3 |
| InChIKey | AWOUZUQSYDHOTQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |