C34H55N5 — CID 158071655
ethane;6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridine;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]azepine;6,7,8,9-tetrahydro-5H-pyrido[4,3-c]azepine (PubChem CID 158071655) has the molecular formula C34H55N5 and a molecular weight of 533.85 g/mol. Its IUPAC name is ethane;6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridine;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]azepine;6,7,8,9-tetrahydro-5H-pyrido[4,3-c]azepine.
| Compound Name | ethane;6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridine;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]azepine;6,7,8,9-tetrahydro-5H-pyrido[4,3-c]azepine |
|---|---|
| PubChem CID | 158071655 |
| Molecular Formula | C34H55N5 |
| Molecular Weight | 533.85 g/mol |
| Exact Mass | 533.45 |
| IUPAC Name | ethane;6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridine;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]azepine;6,7,8,9-tetrahydro-5H-pyrido[4,3-c]azepine |
| SMILES | CC.CC.CC.c1cc2c(cn1)CCCCC2.c1cc2c(cn1)CCCCN2.c1cc2c(cn1)CCCNC2 |
| InChI | InChI=1S/C10H13N.2C9H12N2.3C2H6/c1-2-4-9-6-7-11-8-10(9)5-3-1;1-2-8-6-11-5-3-9(8)7-10-4-1;1-2-5-11-9-4-6-10-7-8(9)3-1;3*1-2/h6-8H,1-5H2;3,5-6,10H,1-2,4,7H2;4,6-7,11H,1-3,5H2;3*1-2H3 |
| InChIKey | FLWUWQYQNMJIEM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.85 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |