C28H24F3N3O2S — CID 166171350
N,2-dimethyl-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide (PubChem CID 166171350) has the molecular formula C28H24F3N3O2S and a molecular weight of 523.58 g/mol. Its IUPAC name is N,2-dimethyl-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide.
| Compound Name | N,2-dimethyl-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide |
|---|---|
| PubChem CID | 166171350 |
| Molecular Formula | C28H24F3N3O2S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N,2-dimethyl-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxamide |
| SMILES | CNC(=O)C1CN(C)Sc2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C28H24F3N3O2S/c1-32-26(36)23-16-33(2)37-27-25(19-10-6-11-21(14-19)28(29,30)31)20(15-24(35)34(23)27)13-18-9-5-8-17-7-3-4-12-22(17)18/h3-12,14-15,23H,13,16H2,1-2H3,(H,32,36) |
| InChIKey | QHHLDLGUDWPHCH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|