C29H25F3N2O5S — CID 166171565
2-[(2R)-2,3-dihydroxypropyl]-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 166171565) has the molecular formula C29H25F3N2O5S and a molecular weight of 570.59 g/mol. Its IUPAC name is 2-[(2R)-2,3-dihydroxypropyl]-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 2-[(2R)-2,3-dihydroxypropyl]-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 166171565 |
| Molecular Formula | C29H25F3N2O5S |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 2-[(2R)-2,3-dihydroxypropyl]-8-(naphthalen-1-ylmethyl)-6-oxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | O=C(O)C1CN(C[C@@H](O)CO)Sc2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C29H25F3N2O5S/c30-29(31,32)21-9-4-8-19(12-21)26-20(11-18-7-3-6-17-5-1-2-10-23(17)18)13-25(37)34-24(28(38)39)15-33(40-27(26)34)14-22(36)16-35/h1-10,12-13,22,24,35-36H,11,14-16H2,(H,38,39)/t22-,24?/m1/s1 |
| InChIKey | AUHUEYNQKZXTEE-LETIRJCYSA-N |
| XLogP | 4.58 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|