C29H23F3N2O7S — CID 163534436
2-[4-methoxycarbonyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazin-2-yl]acetic acid (PubChem CID 163534436) has the molecular formula C29H23F3N2O7S and a molecular weight of 600.57 g/mol. Its IUPAC name is 2-[4-methoxycarbonyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazin-2-yl]acetic acid.
| Compound Name | 2-[4-methoxycarbonyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 163534436 |
| Molecular Formula | C29H23F3N2O7S |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 2-[4-methoxycarbonyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazin-2-yl]acetic acid |
| SMILES | COC(=O)C1CN(CC(=O)O)S(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C29H23F3N2O7S/c1-41-28(38)23-15-33(16-25(36)37)42(39,40)27-26(19-9-5-10-21(13-19)29(30,31)32)20(14-24(35)34(23)27)12-18-8-4-7-17-6-2-3-11-22(17)18/h2-11,13-14,23H,12,15-16H2,1H3,(H,36,37) |
| InChIKey | DVTBPENRTPVDKR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |