C27H20F3NO5S — CID 44556457
methyl (3R)-7-(naphthalen-1-ylmethyl)-1,1,5-trioxo-8-[3-(trifluoromethyl)phenyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate (PubChem CID 44556457) has the molecular formula C27H20F3NO5S and a molecular weight of 527.52 g/mol. Its IUPAC name is methyl (3R)-7-(naphthalen-1-ylmethyl)-1,1,5-trioxo-8-[3-(trifluoromethyl)phenyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate.
| Compound Name | methyl (3R)-7-(naphthalen-1-ylmethyl)-1,1,5-trioxo-8-[3-(trifluoromethyl)phenyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 44556457 |
| Molecular Formula | C27H20F3NO5S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | methyl (3R)-7-(naphthalen-1-ylmethyl)-1,1,5-trioxo-8-[3-(trifluoromethyl)phenyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CS(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C27H20F3NO5S/c1-36-26(33)22-15-37(34,35)25-24(18-9-5-10-20(13-18)27(28,29)30)19(14-23(32)31(22)25)12-17-8-4-7-16-6-2-3-11-21(16)17/h2-11,13-14,22H,12,15H2,1H3/t22-/m0/s1 |
| InChIKey | FNPSSFSPLPFAJA-QFIPXVFZSA-N |
| XLogP | 4.78 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |