C38H35F3N6O7S — CID 166171652
methyl 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate (PubChem CID 166171652) has the molecular formula C38H35F3N6O7S and a molecular weight of 776.79 g/mol. Its IUPAC name is methyl 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate.
| Compound Name | methyl 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 166171652 |
| Molecular Formula | C38H35F3N6O7S |
| Molecular Weight | 776.79 g/mol |
| Exact Mass | 776.22 |
| IUPAC Name | methyl 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
| SMILES | COC(=O)C1CN(CCCCn2cnc3c2c(=O)n(C)c(=O)n3C)S(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C38H35F3N6O7S/c1-43-33-32(34(49)44(2)37(43)51)45(22-42-33)16-6-7-17-46-21-29(36(50)54-3)47-30(48)20-26(18-24-12-8-11-23-10-4-5-15-28(23)24)31(35(47)55(46,52)53)25-13-9-14-27(19-25)38(39,40)41/h4-5,8-15,19-20,22,29H,6-7,16-18,21H2,1-3H3 |
| InChIKey | HDGQOWMUGBULOE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 147.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|