C34H26BrF3N2O6S — CID 172833410
7-bromo-2-[(4-methoxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 172833410) has the molecular formula C34H26BrF3N2O6S and a molecular weight of 727.56 g/mol. Its IUPAC name is 7-bromo-2-[(4-methoxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 7-bromo-2-[(4-methoxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 172833410 |
| Molecular Formula | C34H26BrF3N2O6S |
| Molecular Weight | 727.56 g/mol |
| Exact Mass | 726.06 |
| IUPAC Name | 7-bromo-2-[(4-methoxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | COc1ccc(CN2CC(C(=O)O)n3c(c(-c4cccc(C(F)(F)F)c4)c(Cc4cccc5ccccc45)c(Br)c3=O)S2(=O)=O)cc1 |
| InChI | InChI=1S/C34H26BrF3N2O6S/c1-46-25-14-12-20(13-15-25)18-39-19-28(33(42)43)40-31(41)30(35)27(17-22-8-4-7-21-6-2-3-11-26(21)22)29(32(40)47(39,44)45)23-9-5-10-24(16-23)34(36,37)38/h2-16,28H,17-19H2,1H3,(H,42,43) |
| InChIKey | VUYHJVLZNZJZGO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |