C38H36F3N3O5S — CID 172743565
7-(benzylamino)-2-butyl-3-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 172743565) has the molecular formula C38H36F3N3O5S and a molecular weight of 703.78 g/mol. Its IUPAC name is 7-(benzylamino)-2-butyl-3-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 7-(benzylamino)-2-butyl-3-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 172743565 |
| Molecular Formula | C38H36F3N3O5S |
| Molecular Weight | 703.78 g/mol |
| Exact Mass | 703.23 |
| IUPAC Name | 7-(benzylamino)-2-butyl-3-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCCCN1C(C)C(C(=O)O)n2c(c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)c(NCc3ccccc3)c2=O)S1(=O)=O |
| InChI | InChI=1S/C38H36F3N3O5S/c1-3-4-20-43-24(2)34(37(46)47)44-35(45)33(42-23-25-12-6-5-7-13-25)31(22-27-16-10-15-26-14-8-9-19-30(26)27)32(36(44)50(43,48)49)28-17-11-18-29(21-28)38(39,40)41/h5-19,21,24,34,42H,3-4,20,22-23H2,1-2H3,(H,46,47) |
| InChIKey | JKNQUVXHYQJBNB-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.78 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |