C30H27F3N2O5S — CID 166171574
2-butyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 166171574) has the molecular formula C30H27F3N2O5S and a molecular weight of 584.62 g/mol. Its IUPAC name is 2-butyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 2-butyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 166171574 |
| Molecular Formula | C30H27F3N2O5S |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-butyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCCCN1CC(C(=O)O)n2c(c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc2=O)S1(=O)=O |
| InChI | InChI=1S/C30H27F3N2O5S/c1-2-3-14-34-18-25(29(37)38)35-26(36)17-22(15-20-10-6-9-19-8-4-5-13-24(19)20)27(28(35)41(34,39)40)21-11-7-12-23(16-21)30(31,32)33/h4-13,16-17,25H,2-3,14-15,18H2,1H3,(H,37,38) |
| InChIKey | PRCFALXJFPKYED-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |