C27H20F3NO3S — CID 166171550
2-[2-methylsulfanyl-4-(naphthalen-1-ylmethyl)-6-oxo-3-[3-(trifluoromethyl)phenyl]-1-pyridinyl]prop-2-enoic acid (PubChem CID 166171550) has the molecular formula C27H20F3NO3S and a molecular weight of 495.52 g/mol. Its IUPAC name is 2-[2-methylsulfanyl-4-(naphthalen-1-ylmethyl)-6-oxo-3-[3-(trifluoromethyl)phenyl]-1-pyridinyl]prop-2-enoic acid.
| Compound Name | 2-[2-methylsulfanyl-4-(naphthalen-1-ylmethyl)-6-oxo-3-[3-(trifluoromethyl)phenyl]-1-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166171550 |
| Molecular Formula | C27H20F3NO3S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[2-methylsulfanyl-4-(naphthalen-1-ylmethyl)-6-oxo-3-[3-(trifluoromethyl)phenyl]-1-pyridinyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)n1c(SC)c(-c2cccc(C(F)(F)F)c2)c(Cc2cccc3ccccc23)cc1=O |
| InChI | InChI=1S/C27H20F3NO3S/c1-16(26(33)34)31-23(32)15-20(13-18-9-5-8-17-7-3-4-12-22(17)18)24(25(31)35-2)19-10-6-11-21(14-19)27(28,29)30/h3-12,14-15H,1,13H2,2H3,(H,33,34) |
| InChIKey | AUZPJXOWMQAVHX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|