C34H33F3N2O4S — CID 166171397
7-cyclopentyloxy-8-(naphthalen-1-ylmethyl)-6-oxo-2-propyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 166171397) has the molecular formula C34H33F3N2O4S and a molecular weight of 622.71 g/mol. Its IUPAC name is 7-cyclopentyloxy-8-(naphthalen-1-ylmethyl)-6-oxo-2-propyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 7-cyclopentyloxy-8-(naphthalen-1-ylmethyl)-6-oxo-2-propyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 166171397 |
| Molecular Formula | C34H33F3N2O4S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 7-cyclopentyloxy-8-(naphthalen-1-ylmethyl)-6-oxo-2-propyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCCN1CC(C(=O)O)n2c(c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)c(OC3CCCC3)c2=O)S1 |
| InChI | InChI=1S/C34H33F3N2O4S/c1-2-17-38-20-28(33(41)42)39-31(40)30(43-25-14-4-5-15-25)27(19-22-11-7-10-21-9-3-6-16-26(21)22)29(32(39)44-38)23-12-8-13-24(18-23)34(35,36)37/h3,6-13,16,18,25,28H,2,4-5,14-15,17,19-20H2,1H3,(H,41,42) |
| InChIKey | PELSENHHDCGYLP-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|